How is 2-Pentanol classified?

How is 2-Pentanol classified?

Pentan-2-ol is a secondary alcohol that is pentane substituted at position 2 by a hydroxy group. It has a role as a polar solvent and a metabolite. It is a secondary alcohol and a pentanol.

Which of the following is the correct structure for the compound R )- 2-Pentanol?

C5H12O
(R)-(-)-2-Pentanol | C5H12O – PubChem.

What is the structural formula for Pentanol?

C5H12O1-Pentanol / Formula
1-Pentanol, (or n-pentanol, pentan-1-ol), is an alcohol with five carbon atoms and the molecular formula C5H12O.

What is the bond line formula for 2-Pentanol?

2-Pentanol | C5H12O | ChemSpider.

What does 2-pentanol smell like?

Description. 2-Pentanol is a clear liquid that is soluble in water and alcohol. It has a fermented, alcoholic smell.

Is 2 propanol a primary alcohol?

Isobutyl alcohol is a primary (1º) alcohol, and is easily oxidized. 2-Methyl-2-propanol, or tert-butanol, or tert-butyl alcohol, or t-butyl alcohol, is a three-carbon chain, with the OH group and a methyl group on the middle carbon….

Which of the following is the correct structure for S )- 3 Methylheptane?

3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter. Its refractive index is 1.398 (20 °C, D)….3-Methylheptane.

How do you write pentanol?

1-Pentanol, (or n-pentanol, pentan-1-ol), is an alcohol with five carbon atoms and the molecular formula C5H12O.

What is the melting point of 2-Pentanol?

-99.4°F (-73°C)2-Pentanol / Melting point

Does 2-pentanol have a Stereocenter?

2-pentanol, 2-methylbutan-1-ol, and 2-methylbutan-3-ol each have a single stereocenter, in which the carbon must have 4 different substituents, so they each have an R and S stereoisomer.

Is pentanol drinkable?

The good thing is that if you were to swallow a little bit of pure pentanol, you’d probably be okay as pure pentanol is essentially non-toxic. But if there are impurities in it, it can be dangerous. Some other properties of pentanol include: A melting point of -79 degrees Celsius, which is -110.2 degrees Fahrenheit.

Is 2-pentanol an alcohol?

A secondary alcohol that is pentane substituted at position 2 by a hydroxy group. 2-Pentanol (IUPAC name: pentan-2-ol; also called sec-amyl alcohol) is an organic chemical compound. It is used as a solvent and an intermediate in the manufacturing of other chemicals.

What is the chemical name of +2 pentanol?

2-Pentanol. More… 2-Pentanol, also known as T-amyl alcohol or (+/-)-2-pentanol, belongs to the class of organic compounds known as secondary alcohols. Secondary alcohols are compounds containing a secondary alcohol functional group, with the general structure HOC (R) (R’) (R, R’=alkyl, aryl).

What is 2-pentanol used for?

2-pentanol is a secondary alcohol that is pentane substituted at position 2 by a hydroxy group. It has a role as a polar solvent and a metabolite. It derives from a hydride of a pentane.

What is the structure of 2-pentanol?

2-pentanol is a secondary alcohol that is pentane substituted at position 2 by a hydroxy group. It has a role as a polar solvent and a metabolite. It derives from a hydride of a pentane. Sec-amyl alcohol appears as a clear colorless liquid with a strong odor. Moderately toxic by ingestion and vapors may irritate skin and eyes.